C85H58O9 — CID 58240025
bis[3,5-bis(3,5-diphenoxyphenyl)phenyl]methanone (PubChem CID 58240025) has the molecular formula C85H58O9 and a molecular weight of 1223.39 g/mol. Its IUPAC name is bis[3,5-bis(3,5-diphenoxyphenyl)phenyl]methanone.
| Compound Name | bis[3,5-bis(3,5-diphenoxyphenyl)phenyl]methanone |
|---|---|
| PubChem CID | 58240025 |
| Molecular Formula | C85H58O9 |
| Molecular Weight | 1223.39 g/mol |
| Exact Mass | 1222.41 |
| IUPAC Name | bis[3,5-bis(3,5-diphenoxyphenyl)phenyl]methanone |
| SMILES | O=C(c1cc(-c2cc(Oc3ccccc3)cc(Oc3ccccc3)c2)cc(-c2cc(Oc3ccccc3)cc(Oc3ccccc3)c2)c1)c1cc(-c2cc(Oc3ccccc3)cc(Oc3ccccc3)c2)cc(-c2cc(Oc3ccccc3)cc(Oc3ccccc3)c2)c1 |
| InChI | InChI=1S/C85H58O9/c86-85(67-43-59(63-47-77(87-69-25-9-1-10-26-69)55-78(48-63)88-70-27-11-2-12-28-70)41-60(44-67)64-49-79(89-71-29-13-3-14-30-71)56-80(50-64)90-72-31-15-4-16-32-72)68-45-61(65-51-81(91-73-33-17-5-18-34-73)57-82(52-65)92-74-35-19-6-20-36-74)42-62(46-68)66-53-83(93-75-37-21-7-22-38-75)58-84(54-66)94-76-39-23-8-24-40-76/h1-58H |
| InChIKey | ZFKROTMAEMMCCT-UHFFFAOYSA-N |
| XLogP | 23.92 |
| TPSA | 90.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 94 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1223.39 |
| LogP ≤ 5 | 23.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |