C69H58O5 — CID 58240053
bis[3,5-bis[3-(3,5-dimethylphenoxy)phenyl]phenyl]methanone (PubChem CID 58240053) has the molecular formula C69H58O5 and a molecular weight of 967.22 g/mol. Its IUPAC name is bis[3,5-bis[3-(3,5-dimethylphenoxy)phenyl]phenyl]methanone.
| Compound Name | bis[3,5-bis[3-(3,5-dimethylphenoxy)phenyl]phenyl]methanone |
|---|---|
| PubChem CID | 58240053 |
| Molecular Formula | C69H58O5 |
| Molecular Weight | 967.22 g/mol |
| Exact Mass | 966.43 |
| IUPAC Name | bis[3,5-bis[3-(3,5-dimethylphenoxy)phenyl]phenyl]methanone |
| SMILES | Cc1cc(C)cc(Oc2cccc(-c3cc(C(=O)c4cc(-c5cccc(Oc6cc(C)cc(C)c6)c5)cc(-c5cccc(Oc6cc(C)cc(C)c6)c5)c4)cc(-c4cccc(Oc5cc(C)cc(C)c5)c4)c3)c2)c1 |
| InChI | InChI=1S/C69H58O5/c1-43-21-44(2)26-65(25-43)71-61-17-9-13-51(39-61)55-33-56(52-14-10-18-62(40-52)72-66-27-45(3)22-46(4)28-66)36-59(35-55)69(70)60-37-57(53-15-11-19-63(41-53)73-67-29-47(5)23-48(6)30-67)34-58(38-60)54-16-12-20-64(42-54)74-68-31-49(7)24-50(8)32-68/h9-42H,1-8H3 |
| InChIKey | IEIZSFVLDNYKAQ-UHFFFAOYSA-N |
| XLogP | 19.22 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 967.22 |
| LogP ≤ 5 | 19.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |