C34H22O18S5 — CID 89107673
3-[5-[3-(4,7-disulfonaphthalene-2-carbonyl)-4-hydroxyphenyl]sulfonyl-2-hydroxybenzoyl]naphthalene-1,6-disulfonic acid (PubChem CID 89107673) has the molecular formula C34H22O18S5 and a molecular weight of 878.87 g/mol. Its IUPAC name is 3-[5-[3-(4,7-disulfonaphthalene-2-carbonyl)-4-hydroxyphenyl]sulfonyl-2-hydroxybenzoyl]naphthalene-1,6-disulfonic acid.
| Compound Name | 3-[5-[3-(4,7-disulfonaphthalene-2-carbonyl)-4-hydroxyphenyl]sulfonyl-2-hydroxybenzoyl]naphthalene-1,6-disulfonic acid |
|---|---|
| PubChem CID | 89107673 |
| Molecular Formula | C34H22O18S5 |
| Molecular Weight | 878.87 g/mol |
| Exact Mass | 877.94 |
| IUPAC Name | 3-[5-[3-(4,7-disulfonaphthalene-2-carbonyl)-4-hydroxyphenyl]sulfonyl-2-hydroxybenzoyl]naphthalene-1,6-disulfonic acid |
| SMILES | O=C(c1cc(S(=O)(=O)O)c2ccc(S(=O)(=O)O)cc2c1)c1cc(S(=O)(=O)c2ccc(O)c(C(=O)c3cc(S(=O)(=O)O)c4ccc(S(=O)(=O)O)cc4c3)c2)ccc1O |
| InChI | InChI=1S/C34H22O18S5/c35-29-7-3-21(15-27(29)33(37)19-9-17-11-23(54(41,42)43)1-5-25(17)31(13-19)56(47,48)49)53(39,40)22-4-8-30(36)28(16-22)34(38)20-10-18-12-24(55(44,45)46)2-6-26(18)32(14-20)57(50,51)52/h1-16,35-36H,(H,41,42,43)(H,44,45,46)(H,47,48,49)(H,50,51,52) |
| InChIKey | WAYJNZKQLSQTBE-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 326.22 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 878.87 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|