C14H13NO7S2 — CID 18788755
3-methylsulfonyl-4-(4-sulfamoylphenoxy)benzoic acid (PubChem CID 18788755) has the molecular formula C14H13NO7S2 and a molecular weight of 371.39 g/mol. Its IUPAC name is 3-methylsulfonyl-4-(4-sulfamoylphenoxy)benzoic acid.
| Compound Name | 3-methylsulfonyl-4-(4-sulfamoylphenoxy)benzoic acid |
|---|---|
| PubChem CID | 18788755 |
| Molecular Formula | C14H13NO7S2 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.01 |
| IUPAC Name | 3-methylsulfonyl-4-(4-sulfamoylphenoxy)benzoic acid |
| SMILES | CS(=O)(=O)c1cc(C(=O)O)ccc1Oc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C14H13NO7S2/c1-23(18,19)13-8-9(14(16)17)2-7-12(13)22-10-3-5-11(6-4-10)24(15,20)21/h2-8H,1H3,(H,16,17)(H2,15,20,21) |
| InChIKey | YHUOGLVVNFIRNY-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 140.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |