C25H19NO5S2 — CID 18788891
3-methylsulfonyl-4-[4-(2-quinolin-2-ylethanethioyl)phenoxy]benzoic acid (PubChem CID 18788891) has the molecular formula C25H19NO5S2 and a molecular weight of 477.56 g/mol. Its IUPAC name is 3-methylsulfonyl-4-[4-(2-quinolin-2-ylethanethioyl)phenoxy]benzoic acid.
| Compound Name | 3-methylsulfonyl-4-[4-(2-quinolin-2-ylethanethioyl)phenoxy]benzoic acid |
|---|---|
| PubChem CID | 18788891 |
| Molecular Formula | C25H19NO5S2 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.07 |
| IUPAC Name | 3-methylsulfonyl-4-[4-(2-quinolin-2-ylethanethioyl)phenoxy]benzoic acid |
| SMILES | CS(=O)(=O)c1cc(C(=O)O)ccc1Oc1ccc(C(=S)Cc2ccc3ccccc3n2)cc1 |
| InChI | InChI=1S/C25H19NO5S2/c1-33(29,30)24-14-18(25(27)28)9-13-22(24)31-20-11-7-17(8-12-20)23(32)15-19-10-6-16-4-2-3-5-21(16)26-19/h2-14H,15H2,1H3,(H,27,28) |
| InChIKey | JTALORLXEKYTTL-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 93.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|