C14H12N2O7S2 — CID 18972255
6-(5-methyl-3-oxo-1H-pyrazol-2-yl)naphthalene-1,3-disulfonic acid (PubChem CID 18972255) has the molecular formula C14H12N2O7S2 and a molecular weight of 384.39 g/mol. Its IUPAC name is 6-(5-methyl-3-oxo-1H-pyrazol-2-yl)naphthalene-1,3-disulfonic acid.
| Compound Name | 6-(5-methyl-3-oxo-1H-pyrazol-2-yl)naphthalene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 18972255 |
| Molecular Formula | C14H12N2O7S2 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.01 |
| IUPAC Name | 6-(5-methyl-3-oxo-1H-pyrazol-2-yl)naphthalene-1,3-disulfonic acid |
| SMILES | Cc1cc(=O)n(-c2ccc3c(S(=O)(=O)O)cc(S(=O)(=O)O)cc3c2)[nH]1 |
| InChI | InChI=1S/C14H12N2O7S2/c1-8-4-14(17)16(15-8)10-2-3-12-9(5-10)6-11(24(18,19)20)7-13(12)25(21,22)23/h2-7,15H,1H3,(H,18,19,20)(H,21,22,23) |
| InChIKey | KENOQRCLUFMNHC-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 146.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|