C31H25Cl2N5O10S4 — CID 163681102
6-[5-tert-butyl-4-[[2,6-dichloro-4-(6-methyl-7-sulfo-1,3-benzothiazol-2-yl)phenyl]diazenyl]-3-oxo-1H-pyrazol-2-yl]naphthalene-1,3-disulfonic acid (PubChem CID 163681102) has the molecular formula C31H25Cl2N5O10S4 and a molecular weight of 826.74 g/mol. Its IUPAC name is 6-[5-tert-butyl-4-[[2,6-dichloro-4-(6-methyl-7-sulfo-1,3-benzothiazol-2-yl)phenyl]diazenyl]-3-oxo-1H-pyrazol-2-yl]naphthalene-1,3-disulfonic acid.
| Compound Name | 6-[5-tert-butyl-4-[[2,6-dichloro-4-(6-methyl-7-sulfo-1,3-benzothiazol-2-yl)phenyl]diazenyl]-3-oxo-1H-pyrazol-2-yl]naphthalene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 163681102 |
| Molecular Formula | C31H25Cl2N5O10S4 |
| Molecular Weight | 826.74 g/mol |
| Exact Mass | 824.99 |
| IUPAC Name | 6-[5-tert-butyl-4-[[2,6-dichloro-4-(6-methyl-7-sulfo-1,3-benzothiazol-2-yl)phenyl]diazenyl]-3-oxo-1H-pyrazol-2-yl]naphthalene-1,3-disulfonic acid |
| SMILES | Cc1ccc2nc(-c3cc(Cl)c(/N=N/c4c(C(C)(C)C)[nH]n(-c5ccc6c(S(=O)(=O)O)cc(S(=O)(=O)O)cc6c5)c4=O)c(Cl)c3)sc2c1S(=O)(=O)O |
| InChI | InChI=1S/C31H25Cl2N5O10S4/c1-14-5-8-22-26(27(14)52(46,47)48)49-29(34-22)16-11-20(32)24(21(33)12-16)35-36-25-28(31(2,3)4)37-38(30(25)39)17-6-7-19-15(9-17)10-18(50(40,41)42)13-23(19)51(43,44)45/h5-13,37H,1-4H3,(H,40,41,42)(H,43,44,45)(H,46,47,48)/b36-35+ |
| InChIKey | NYNLPOMQISDGDT-ULDVOPSXSA-N |
| XLogP | 7.66 |
| TPSA | 238.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 826.74 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|