C27H22N4O5S — CID 135404155
4-[[2-(3,4-dimethylphenyl)-3-oxo-5-phenyl-1H-pyrazol-4-yl]diazenyl]-3-hydroxynaphthalene-1-sulfonic acid (PubChem CID 135404155) has the molecular formula C27H22N4O5S and a molecular weight of 514.56 g/mol. Its IUPAC name is 4-[[2-(3,4-dimethylphenyl)-3-oxo-5-phenyl-1H-pyrazol-4-yl]diazenyl]-3-hydroxynaphthalene-1-sulfonic acid.
| Compound Name | 4-[[2-(3,4-dimethylphenyl)-3-oxo-5-phenyl-1H-pyrazol-4-yl]diazenyl]-3-hydroxynaphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 135404155 |
| Molecular Formula | C27H22N4O5S |
| Molecular Weight | 514.56 g/mol |
| Exact Mass | 514.13 |
| IUPAC Name | 4-[[2-(3,4-dimethylphenyl)-3-oxo-5-phenyl-1H-pyrazol-4-yl]diazenyl]-3-hydroxynaphthalene-1-sulfonic acid |
| SMILES | Cc1ccc(-n2[nH]c(-c3ccccc3)c(/N=N/c3c(O)cc(S(=O)(=O)O)c4ccccc34)c2=O)cc1C |
| InChI | InChI=1S/C27H22N4O5S/c1-16-12-13-19(14-17(16)2)31-27(33)26(24(30-31)18-8-4-3-5-9-18)29-28-25-21-11-7-6-10-20(21)23(15-22(25)32)37(34,35)36/h3-15,30,32H,1-2H3,(H,34,35,36)/b29-28+ |
| InChIKey | CBQIATZZIJUXJE-ZQHSETAFSA-N |
| XLogP | 5.97 |
| TPSA | 137.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.56 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|