C21H15F3N4O5S — CID 135484044
3-hydroxy-4-[[5-methyl-3-oxo-2-[3-(trifluoromethyl)phenyl]-1H-pyrazol-4-yl]diazenyl]naphthalene-1-sulfonic acid (PubChem CID 135484044) has the molecular formula C21H15F3N4O5S and a molecular weight of 492.44 g/mol. Its IUPAC name is 3-hydroxy-4-[[5-methyl-3-oxo-2-[3-(trifluoromethyl)phenyl]-1H-pyrazol-4-yl]diazenyl]naphthalene-1-sulfonic acid.
| Compound Name | 3-hydroxy-4-[[5-methyl-3-oxo-2-[3-(trifluoromethyl)phenyl]-1H-pyrazol-4-yl]diazenyl]naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 135484044 |
| Molecular Formula | C21H15F3N4O5S |
| Molecular Weight | 492.44 g/mol |
| Exact Mass | 492.07 |
| IUPAC Name | 3-hydroxy-4-[[5-methyl-3-oxo-2-[3-(trifluoromethyl)phenyl]-1H-pyrazol-4-yl]diazenyl]naphthalene-1-sulfonic acid |
| SMILES | Cc1[nH]n(-c2cccc(C(F)(F)F)c2)c(=O)c1/N=N/c1c(O)cc(S(=O)(=O)O)c2ccccc12 |
| InChI | InChI=1S/C21H15F3N4O5S/c1-11-18(20(30)28(27-11)13-6-4-5-12(9-13)21(22,23)24)25-26-19-15-8-3-2-7-14(15)17(10-16(19)29)34(31,32)33/h2-10,27,29H,1H3,(H,31,32,33)/b26-25+ |
| InChIKey | FFAVEPICBVBNIY-OCEACIFDSA-N |
| XLogP | 5.01 |
| TPSA | 137.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.44 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|