C27H21N9O12S2 — CID 135587717
2-[[4-[[3,6-bis(aminooxysulfonyl)-7-[(2-carboxyphenyl)diazenyl]-8-hydroxynaphthalen-1-yl]amino]-6-hydroxy-1,3,5-triazin-2-yl]amino]benzoic acid (PubChem CID 135587717) has the molecular formula C27H21N9O12S2 and a molecular weight of 727.65 g/mol. Its IUPAC name is 2-[[4-[[3,6-bis(aminooxysulfonyl)-7-[(2-carboxyphenyl)diazenyl]-8-hydroxynaphthalen-1-yl]amino]-6-hydroxy-1,3,5-triazin-2-yl]amino]benzoic acid.
| Compound Name | 2-[[4-[[3,6-bis(aminooxysulfonyl)-7-[(2-carboxyphenyl)diazenyl]-8-hydroxynaphthalen-1-yl]amino]-6-hydroxy-1,3,5-triazin-2-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 135587717 |
| Molecular Formula | C27H21N9O12S2 |
| Molecular Weight | 727.65 g/mol |
| Exact Mass | 727.08 |
| IUPAC Name | 2-[[4-[[3,6-bis(aminooxysulfonyl)-7-[(2-carboxyphenyl)diazenyl]-8-hydroxynaphthalen-1-yl]amino]-6-hydroxy-1,3,5-triazin-2-yl]amino]benzoic acid |
| SMILES | NOS(=O)(=O)c1cc(Nc2nc(O)nc(Nc3ccccc3C(=O)O)n2)c2c(O)c(/N=N/c3ccccc3C(=O)O)c(S(=O)(=O)ON)cc2c1 |
| InChI | InChI=1S/C27H21N9O12S2/c28-47-49(43,44)13-9-12-10-19(50(45,46)48-29)21(36-35-17-8-4-2-6-15(17)24(40)41)22(37)20(12)18(11-13)31-26-32-25(33-27(42)34-26)30-16-7-3-1-5-14(16)23(38)39/h1-11,37H,28-29H2,(H,38,39)(H,40,41)(H3,30,31,32,33,34,42)/b36-35+ |
| InChIKey | YZOMZFBCGOZVSH-ULDVOPSXSA-N |
| XLogP | 2.89 |
| TPSA | 341.29 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.65 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|