C20H11N2O10S3-3 — CID 135962620
3-oxido-4-[[4-(trioxidanylsulfanyl)naphthalen-1-yl]diazenyl]naphthalene-2,7-disulfonate (PubChem CID 135962620) has the molecular formula C20H11N2O10S3-3 and a molecular weight of 535.51 g/mol. Its IUPAC name is 3-oxido-4-[[4-(trioxidanylsulfanyl)naphthalen-1-yl]diazenyl]naphthalene-2,7-disulfonate.
| Compound Name | 3-oxido-4-[[4-(trioxidanylsulfanyl)naphthalen-1-yl]diazenyl]naphthalene-2,7-disulfonate |
|---|---|
| PubChem CID | 135962620 |
| Molecular Formula | C20H11N2O10S3-3 |
| Molecular Weight | 535.51 g/mol |
| Exact Mass | 534.96 |
| IUPAC Name | 3-oxido-4-[[4-(trioxidanylsulfanyl)naphthalen-1-yl]diazenyl]naphthalene-2,7-disulfonate |
| SMILES | O=S(=O)([O-])c1ccc2c(/N=N/c3ccc(SOOO)c4ccccc34)c([O-])c(S(=O)(=O)[O-])cc2c1 |
| InChI | InChI=1S/C20H14N2O10S3/c23-20-18(35(28,29)30)10-11-9-12(34(25,26)27)5-6-13(11)19(20)22-21-16-7-8-17(33-32-31-24)15-4-2-1-3-14(15)16/h1-10,23-24H,(H,25,26,27)(H,28,29,30)/p-3/b22-21+ |
| InChIKey | BGVWNHXXGSQTAN-QURGRASLSA-K |
| XLogP | 3.72 |
| TPSA | 200.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.51 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|