C24H18N4Na2O7S2 — CID 21343292
disodium;7-[[4-[(4-amino-2-methylphenyl)diazenyl]benzoyl]amino]-3-oxidoperoxysulfanylnaphthalene-1-sulfonate (PubChem CID 21343292) has the molecular formula C24H18N4Na2O7S2 and a molecular weight of 584.54 g/mol. Its IUPAC name is disodium;7-[[4-[(4-amino-2-methylphenyl)diazenyl]benzoyl]amino]-3-oxidoperoxysulfanylnaphthalene-1-sulfonate.
| Compound Name | disodium;7-[[4-[(4-amino-2-methylphenyl)diazenyl]benzoyl]amino]-3-oxidoperoxysulfanylnaphthalene-1-sulfonate |
|---|---|
| PubChem CID | 21343292 |
| Molecular Formula | C24H18N4Na2O7S2 |
| Molecular Weight | 584.54 g/mol |
| Exact Mass | 584.04 |
| IUPAC Name | disodium;7-[[4-[(4-amino-2-methylphenyl)diazenyl]benzoyl]amino]-3-oxidoperoxysulfanylnaphthalene-1-sulfonate |
| SMILES | Cc1cc(N)ccc1/N=N/c1ccc(C(=O)Nc2ccc3cc(SOO[O-])cc(S(=O)(=O)[O-])c3c2)cc1.[Na+].[Na+] |
| InChI | InChI=1S/C24H20N4O7S2.2Na/c1-14-10-17(25)5-9-22(14)28-27-18-6-2-15(3-7-18)24(29)26-19-8-4-16-11-20(36-35-34-30)13-23(21(16)12-19)37(31,32)33;;/h2-13,30H,25H2,1H3,(H,26,29)(H,31,32,33);;/q;2*+1/p-2/b28-27+;; |
| InChIKey | DFFYETSDTABKJI-JZYARHMISA-L |
| XLogP | -1.46 |
| TPSA | 178.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.54 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|