3-(aminodiazenyl)benzene-1,2-disulfonic acid

C6H7N3O6S2 — CID 88516198

IUPAC3-(aminodiazenyl)benzene-1,2-disulfonic acid
SMILESN/N=N/c1cccc(S(=O)(=O)O)c1S(=O)(=O)O
InChIInChI=1S/C6H7N3O6S2/c7-9-8-4-2-1-3-5(16(10,11)12)6(4)17(13,14)15/h1-3H,(H2,7,8)(H,10,11,12)(H,13,14,15)
InChIKeyBHKWXQBWGLKDKU-UHFFFAOYSA-N
MW281.27 g/mol
LogP0.14
Rot. Bonds3

About 3-(aminodiazenyl)benzene-1,2-disulfonic acid

3-(aminodiazenyl)benzene-1,2-disulfonic acid (PubChem CID 88516198) has the molecular formula C6H7N3O6S2 and a molecular weight of 281.27 g/mol. Its IUPAC name is 3-(aminodiazenyl)benzene-1,2-disulfonic acid.

Molecular Properties

Compound Name3-(aminodiazenyl)benzene-1,2-disulfonic acid
PubChem CID88516198
Molecular FormulaC6H7N3O6S2
Molecular Weight281.27 g/mol
Exact Mass280.98
IUPAC Name3-(aminodiazenyl)benzene-1,2-disulfonic acid
SMILESN/N=N/c1cccc(S(=O)(=O)O)c1S(=O)(=O)O
InChIInChI=1S/C6H7N3O6S2/c7-9-8-4-2-1-3-5(16(10,11)12)6(4)17(13,14)15/h1-3H,(H2,7,8)(H,10,11,12)(H,13,14,15)
InChIKeyBHKWXQBWGLKDKU-UHFFFAOYSA-N
XLogP0.14
TPSA159.48 Ų
H-Bond Donors3
H-Bond Acceptors6
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500281.27
LogP ≤ 50.14
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 3-(aminodiazenyl)benzene-1,2-disulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(aminodiazenyl)benzene-1,2-disulfonic acid?
The IUPAC name of 3-(aminodiazenyl)benzene-1,2-disulfonic acid (CID 88516198) is 3-(aminodiazenyl)benzene-1,2-disulfonic acid.
What is the SMILES notation for 3-(aminodiazenyl)benzene-1,2-disulfonic acid?
The canonical SMILES for 3-(aminodiazenyl)benzene-1,2-disulfonic acid is N/N=N/c1cccc(S(=O)(=O)O)c1S(=O)(=O)O.
What is the InChIKey of 3-(aminodiazenyl)benzene-1,2-disulfonic acid?
The InChIKey is BHKWXQBWGLKDKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N3O6S2/c7-9-8-4-2-1-3-5(16(10,11)12)6(4)17(13,14)15/h1-3H,(H2,7,8)(H,10,11,12)(H,13,14,15).
What are the key properties of 3-(aminodiazenyl)benzene-1,2-disulfonic acid?
3-(aminodiazenyl)benzene-1,2-disulfonic acid has a molecular weight of 281.27 g/mol, XLogP of 0.14, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(aminodiazenyl)benzene-1,2-disulfonic acid is sourced from PubChem (CID 88516198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).