C6H7N3O6S2 — CID 88516198
3-(aminodiazenyl)benzene-1,2-disulfonic acid (PubChem CID 88516198) has the molecular formula C6H7N3O6S2 and a molecular weight of 281.27 g/mol. Its IUPAC name is 3-(aminodiazenyl)benzene-1,2-disulfonic acid.
| Compound Name | 3-(aminodiazenyl)benzene-1,2-disulfonic acid |
|---|---|
| PubChem CID | 88516198 |
| Molecular Formula | C6H7N3O6S2 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 280.98 |
| IUPAC Name | 3-(aminodiazenyl)benzene-1,2-disulfonic acid |
| SMILES | N/N=N/c1cccc(S(=O)(=O)O)c1S(=O)(=O)O |
| InChI | InChI=1S/C6H7N3O6S2/c7-9-8-4-2-1-3-5(16(10,11)12)6(4)17(13,14)15/h1-3H,(H2,7,8)(H,10,11,12)(H,13,14,15) |
| InChIKey | BHKWXQBWGLKDKU-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 159.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|