C40H36N4O10S2 — CID 136818470
5-[[4-[1-[4-[(2,8-dihydroxy-5-sulfonaphthalen-1-yl)diazenyl]-3-methylphenyl]cyclohexyl]-2-methylphenyl]diazenyl]-4,6-dihydroxynaphthalene-1-sulfonic acid (PubChem CID 136818470) has the molecular formula C40H36N4O10S2 and a molecular weight of 796.88 g/mol. Its IUPAC name is 5-[[4-[1-[4-[(2,8-dihydroxy-5-sulfonaphthalen-1-yl)diazenyl]-3-methylphenyl]cyclohexyl]-2-methylphenyl]diazenyl]-4,6-dihydroxynaphthalene-1-sulfonic acid.
| Compound Name | 5-[[4-[1-[4-[(2,8-dihydroxy-5-sulfonaphthalen-1-yl)diazenyl]-3-methylphenyl]cyclohexyl]-2-methylphenyl]diazenyl]-4,6-dihydroxynaphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 136818470 |
| Molecular Formula | C40H36N4O10S2 |
| Molecular Weight | 796.88 g/mol |
| Exact Mass | 796.19 |
| IUPAC Name | 5-[[4-[1-[4-[(2,8-dihydroxy-5-sulfonaphthalen-1-yl)diazenyl]-3-methylphenyl]cyclohexyl]-2-methylphenyl]diazenyl]-4,6-dihydroxynaphthalene-1-sulfonic acid |
| SMILES | Cc1cc(C2(c3ccc(/N=N/c4c(O)ccc5c(S(=O)(=O)O)ccc(O)c45)c(C)c3)CCCCC2)ccc1/N=N/c1c(O)ccc2c(S(=O)(=O)O)ccc(O)c12 |
| InChI | InChI=1S/C40H36N4O10S2/c1-22-20-24(6-10-28(22)41-43-38-32(47)12-8-26-34(55(49,50)51)16-14-30(45)36(26)38)40(18-4-3-5-19-40)25-7-11-29(23(2)21-25)42-44-39-33(48)13-9-27-35(56(52,53)54)17-15-31(46)37(27)39/h6-17,20-21,45-48H,3-5,18-19H2,1-2H3,(H,49,50,51)(H,52,53,54)/b43-41+,44-42+ |
| InChIKey | OZZYAUCWJIXYKD-CHQNLTHESA-N |
| XLogP | 10.01 |
| TPSA | 239.10 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.88 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|