C7H5NO5S — CID 169355860
4-hydroxy-3-isocyanatobenzenesulfonic acid (PubChem CID 169355860) has the molecular formula C7H5NO5S and a molecular weight of 215.19 g/mol. Its IUPAC name is 4-hydroxy-3-isocyanatobenzenesulfonic acid.
| Compound Name | 4-hydroxy-3-isocyanatobenzenesulfonic acid |
|---|---|
| PubChem CID | 169355860 |
| Molecular Formula | C7H5NO5S |
| Molecular Weight | 215.19 g/mol |
| Exact Mass | 214.99 |
| IUPAC Name | 4-hydroxy-3-isocyanatobenzenesulfonic acid |
| SMILES | O=C=Nc1cc(S(=O)(=O)O)ccc1O |
| InChI | InChI=1S/C7H5NO5S/c9-4-8-6-3-5(14(11,12)13)1-2-7(6)10/h1-3,10H,(H,11,12,13) |
| InChIKey | JOSNXUAHZMYHKS-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 104.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.19 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|