C14H11N9O2S3 — CID 5475797
4-[(2-amino-6-sulfanylidene-3,5-dihydropurin-8-yl)diazenyl]-N-(1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 5475797) has the molecular formula C14H11N9O2S3 and a molecular weight of 433.50 g/mol. Its IUPAC name is 4-[(2-amino-6-sulfanylidene-3,5-dihydropurin-8-yl)diazenyl]-N-(1,3-thiazol-2-yl)benzenesulfonamide.
| Compound Name | 4-[(2-amino-6-sulfanylidene-3,5-dihydropurin-8-yl)diazenyl]-N-(1,3-thiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 5475797 |
| Molecular Formula | C14H11N9O2S3 |
| Molecular Weight | 433.50 g/mol |
| Exact Mass | 433.02 |
| IUPAC Name | 4-[(2-amino-6-sulfanylidene-3,5-dihydropurin-8-yl)diazenyl]-N-(1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | NC1=NC(=S)C2N=C(/N=N/c3ccc(S(=O)(=O)Nc4nccs4)cc3)N=C2N1 |
| InChI | InChI=1S/C14H11N9O2S3/c15-12-18-10-9(11(26)20-12)17-13(19-10)22-21-7-1-3-8(4-2-7)28(24,25)23-14-16-5-6-27-14/h1-6,9H,(H,16,23)(H3,15,17,18,19,20,26)/b22-21+ |
| InChIKey | LVBKRZSNXKHWMG-QURGRASLSA-N |
| XLogP | 1.41 |
| TPSA | 158.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.50 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|