C15H13N3O2S3 — CID 10919389
N-(1,3-thiazol-2-yl)-4-(1-thiophen-2-ylethylideneamino)benzenesulfonamide (PubChem CID 10919389) has the molecular formula C15H13N3O2S3 and a molecular weight of 363.49 g/mol. Its IUPAC name is N-(1,3-thiazol-2-yl)-4-(1-thiophen-2-ylethylideneamino)benzenesulfonamide.
| Compound Name | N-(1,3-thiazol-2-yl)-4-(1-thiophen-2-ylethylideneamino)benzenesulfonamide |
|---|---|
| PubChem CID | 10919389 |
| Molecular Formula | C15H13N3O2S3 |
| Molecular Weight | 363.49 g/mol |
| Exact Mass | 363.02 |
| IUPAC Name | N-(1,3-thiazol-2-yl)-4-(1-thiophen-2-ylethylideneamino)benzenesulfonamide |
| SMILES | C/C(=N\c1ccc(S(=O)(=O)Nc2nccs2)cc1)c1cccs1 |
| InChI | InChI=1S/C15H13N3O2S3/c1-11(14-3-2-9-21-14)17-12-4-6-13(7-5-12)23(19,20)18-15-16-8-10-22-15/h2-10H,1H3,(H,16,18)/b17-11+ |
| InChIKey | YBWLXKSUKAEFJX-GZTJUZNOSA-N |
| XLogP | 4.15 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.49 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|