C22H20N6O6S3 — CID 136740266
4-[(8-hydroxy-5-morpholin-4-ylsulfonylquinolin-7-yl)diazenyl]-N-(1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 136740266) has the molecular formula C22H20N6O6S3 and a molecular weight of 560.64 g/mol. Its IUPAC name is 4-[(8-hydroxy-5-morpholin-4-ylsulfonylquinolin-7-yl)diazenyl]-N-(1,3-thiazol-2-yl)benzenesulfonamide.
| Compound Name | 4-[(8-hydroxy-5-morpholin-4-ylsulfonylquinolin-7-yl)diazenyl]-N-(1,3-thiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 136740266 |
| Molecular Formula | C22H20N6O6S3 |
| Molecular Weight | 560.64 g/mol |
| Exact Mass | 560.06 |
| IUPAC Name | 4-[(8-hydroxy-5-morpholin-4-ylsulfonylquinolin-7-yl)diazenyl]-N-(1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1nccs1)c1ccc(/N=N/c2cc(S(=O)(=O)N3CCOCC3)c3cccnc3c2O)cc1 |
| InChI | InChI=1S/C22H20N6O6S3/c29-21-18(26-25-15-3-5-16(6-4-15)36(30,31)27-22-24-8-13-35-22)14-19(17-2-1-7-23-20(17)21)37(32,33)28-9-11-34-12-10-28/h1-8,13-14,29H,9-12H2,(H,24,27)/b26-25+ |
| InChIKey | YQULKHNCEIXVBI-OCEACIFDSA-N |
| XLogP | 3.63 |
| TPSA | 163.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.64 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|