C18H21N3O3 — CID 71896912
[2-(cyclopropylmethylamino)-2-oxoethyl] 2,5-dimethyl-1-pyridin-2-ylpyrrole-3-carboxylate (PubChem CID 71896912) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is [2-(cyclopropylmethylamino)-2-oxoethyl] 2,5-dimethyl-1-pyridin-2-ylpyrrole-3-carboxylate.
| Compound Name | [2-(cyclopropylmethylamino)-2-oxoethyl] 2,5-dimethyl-1-pyridin-2-ylpyrrole-3-carboxylate |
|---|---|
| PubChem CID | 71896912 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | [2-(cyclopropylmethylamino)-2-oxoethyl] 2,5-dimethyl-1-pyridin-2-ylpyrrole-3-carboxylate |
| SMILES | Cc1cc(C(=O)OCC(=O)NCC2CC2)c(C)n1-c1ccccn1 |
| InChI | InChI=1S/C18H21N3O3/c1-12-9-15(13(2)21(12)16-5-3-4-8-19-16)18(23)24-11-17(22)20-10-14-6-7-14/h3-5,8-9,14H,6-7,10-11H2,1-2H3,(H,20,22) |
| InChIKey | PMZSSOGEWZABHZ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|