About [2-(2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)-2-oxoethyl] 1H-indole-3-carboxylate
[2-(2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)-2-oxoethyl] 1H-indole-3-carboxylate (PubChem CID 9380674) has the molecular formula C22H19N3O3
and a molecular weight of 373.41 g/mol. Its IUPAC name is [2-(2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)-2-oxoethyl] 1H-indole-3-carboxylate.
Molecular Properties
| Compound Name | [2-(2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)-2-oxoethyl] 1H-indole-3-carboxylate |
| PubChem CID | 9380674 |
| Molecular Formula | C22H19N3O3 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | [2-(2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)-2-oxoethyl] 1H-indole-3-carboxylate |
| SMILES | Cc1cc(C(=O)COC(=O)c2c[nH]c3ccccc23)c(C)n1-c1ccccn1 |
| InChI | InChI=1S/C22H19N3O3/c1-14-11-17(15(2)25(14)21-9-5-6-10-23-21)20(26)13-28-22(27)18-12-24-19-8-4-3-7-16(18)19/h3-12,24H,13H2,1-2H3 |
| InChIKey | QYXWHGCJVILGJX-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 76.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|
Analyze [2-(2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)-2-oxoethyl] 1H-indole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)-2-oxoethyl] 1H-indole-3-carboxylate?
The IUPAC name of [2-(2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)-2-oxoethyl] 1H-indole-3-carboxylate (CID 9380674) is [2-(2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)-2-oxoethyl] 1H-indole-3-carboxylate.
What is the SMILES notation for [2-(2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)-2-oxoethyl] 1H-indole-3-carboxylate?
The canonical SMILES for [2-(2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)-2-oxoethyl] 1H-indole-3-carboxylate is Cc1cc(C(=O)COC(=O)c2c[nH]c3ccccc23)c(C)n1-c1ccccn1.
What is the InChIKey of [2-(2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)-2-oxoethyl] 1H-indole-3-carboxylate?
The InChIKey is QYXWHGCJVILGJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19N3O3/c1-14-11-17(15(2)25(14)21-9-5-6-10-23-21)20(26)13-28-22(27)18-12-24-19-8-4-3-7-16(18)19/h3-12,24H,13H2,1-2H3.
What are the key properties of [2-(2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)-2-oxoethyl] 1H-indole-3-carboxylate?
[2-(2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)-2-oxoethyl] 1H-indole-3-carboxylate has a molecular weight of 373.41 g/mol, XLogP of 4.01, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)-2-oxoethyl] 1H-indole-3-carboxylate is sourced from PubChem (CID 9380674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).