C22H19N3O3 — CID 9380674
[2-(2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)-2-oxoethyl] 1H-indole-3-carboxylate (PubChem CID 9380674) has the molecular formula C22H19N3O3 and a molecular weight of 373.41 g/mol. Its IUPAC name is [2-(2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)-2-oxoethyl] 1H-indole-3-carboxylate.
| Compound Name | [2-(2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)-2-oxoethyl] 1H-indole-3-carboxylate |
|---|---|
| PubChem CID | 9380674 |
| Molecular Formula | C22H19N3O3 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | [2-(2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)-2-oxoethyl] 1H-indole-3-carboxylate |
| SMILES | Cc1cc(C(=O)COC(=O)c2c[nH]c3ccccc23)c(C)n1-c1ccccn1 |
| InChI | InChI=1S/C22H19N3O3/c1-14-11-17(15(2)25(14)21-9-5-6-10-23-21)20(26)13-28-22(27)18-12-24-19-8-4-3-7-16(18)19/h3-12,24H,13H2,1-2H3 |
| InChIKey | QYXWHGCJVILGJX-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 76.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|