C19H17N3O4 — CID 135843576
5-[[4-[(3,4-dimethyl-1,2-oxazol-5-yl)methyl]phenyl]diazenyl]-2-hydroxybenzoic acid (PubChem CID 135843576) has the molecular formula C19H17N3O4 and a molecular weight of 351.36 g/mol. Its IUPAC name is 5-[[4-[(3,4-dimethyl-1,2-oxazol-5-yl)methyl]phenyl]diazenyl]-2-hydroxybenzoic acid.
| Compound Name | 5-[[4-[(3,4-dimethyl-1,2-oxazol-5-yl)methyl]phenyl]diazenyl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 135843576 |
| Molecular Formula | C19H17N3O4 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | 5-[[4-[(3,4-dimethyl-1,2-oxazol-5-yl)methyl]phenyl]diazenyl]-2-hydroxybenzoic acid |
| SMILES | Cc1noc(Cc2ccc(/N=N/c3ccc(O)c(C(=O)O)c3)cc2)c1C |
| InChI | InChI=1S/C19H17N3O4/c1-11-12(2)22-26-18(11)9-13-3-5-14(6-4-13)20-21-15-7-8-17(23)16(10-15)19(24)25/h3-8,10,23H,9H2,1-2H3,(H,24,25)/b21-20+ |
| InChIKey | DSNHRZHAVOSFDO-QZQOTICOSA-N |
| XLogP | 4.70 |
| TPSA | 108.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|