C12H11F2NO5S — CID 78910261
2-[[2-(difluoromethylsulfanyl)benzoyl]amino]butanedioic acid (PubChem CID 78910261) has the molecular formula C12H11F2NO5S and a molecular weight of 319.29 g/mol. Its IUPAC name is 2-[[2-(difluoromethylsulfanyl)benzoyl]amino]butanedioic acid.
| Compound Name | 2-[[2-(difluoromethylsulfanyl)benzoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 78910261 |
| Molecular Formula | C12H11F2NO5S |
| Molecular Weight | 319.29 g/mol |
| Exact Mass | 319.03 |
| IUPAC Name | 2-[[2-(difluoromethylsulfanyl)benzoyl]amino]butanedioic acid |
| SMILES | O=C(O)CC(NC(=O)c1ccccc1SC(F)F)C(=O)O |
| InChI | InChI=1S/C12H11F2NO5S/c13-12(14)21-8-4-2-1-3-6(8)10(18)15-7(11(19)20)5-9(16)17/h1-4,7,12H,5H2,(H,15,18)(H,16,17)(H,19,20) |
| InChIKey | HYRMRLFIEIASTI-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.29 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |