C11H11F2NO3S — CID 54990748
(2R)-2-[[2-(difluoromethylsulfanyl)benzoyl]amino]propanoic acid (PubChem CID 54990748) has the molecular formula C11H11F2NO3S and a molecular weight of 275.28 g/mol. Its IUPAC name is (2R)-2-[[2-(difluoromethylsulfanyl)benzoyl]amino]propanoic acid.
| Compound Name | (2R)-2-[[2-(difluoromethylsulfanyl)benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 54990748 |
| Molecular Formula | C11H11F2NO3S |
| Molecular Weight | 275.28 g/mol |
| Exact Mass | 275.04 |
| IUPAC Name | (2R)-2-[[2-(difluoromethylsulfanyl)benzoyl]amino]propanoic acid |
| SMILES | C[C@@H](NC(=O)c1ccccc1SC(F)F)C(=O)O |
| InChI | InChI=1S/C11H11F2NO3S/c1-6(10(16)17)14-9(15)7-4-2-3-5-8(7)18-11(12)13/h2-6,11H,1H3,(H,14,15)(H,16,17)/t6-/m1/s1 |
| InChIKey | QJUDFIFTVSYGJL-ZCFIWIBFSA-N |
| XLogP | 2.20 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.28 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |