C13H14N4O4 — CID 167788429
(2S)-5-amino-2-(1H-indazole-7-carbonylamino)-5-oxopentanoic acid (PubChem CID 167788429) has the molecular formula C13H14N4O4 and a molecular weight of 290.28 g/mol. Its IUPAC name is (2S)-5-amino-2-(1H-indazole-7-carbonylamino)-5-oxopentanoic acid.
| Compound Name | (2S)-5-amino-2-(1H-indazole-7-carbonylamino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 167788429 |
| Molecular Formula | C13H14N4O4 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | (2S)-5-amino-2-(1H-indazole-7-carbonylamino)-5-oxopentanoic acid |
| SMILES | NC(=O)CC[C@H](NC(=O)c1cccc2cn[nH]c12)C(=O)O |
| InChI | InChI=1S/C13H14N4O4/c14-10(18)5-4-9(13(20)21)16-12(19)8-3-1-2-7-6-15-17-11(7)8/h1-3,6,9H,4-5H2,(H2,14,18)(H,15,17)(H,16,19)(H,20,21)/t9-/m0/s1 |
| InChIKey | WOPLJVQOIWIVSO-VIFPVBQESA-N |
| XLogP | 0.01 |
| TPSA | 138.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |