C9H10N4O6 — CID 43208890
4-amino-2-[(5-nitro-1H-pyrrole-2-carbonyl)amino]-4-oxobutanoic acid (PubChem CID 43208890) has the molecular formula C9H10N4O6 and a molecular weight of 270.20 g/mol. Its IUPAC name is 4-amino-2-[(5-nitro-1H-pyrrole-2-carbonyl)amino]-4-oxobutanoic acid.
| Compound Name | 4-amino-2-[(5-nitro-1H-pyrrole-2-carbonyl)amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 43208890 |
| Molecular Formula | C9H10N4O6 |
| Molecular Weight | 270.20 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | 4-amino-2-[(5-nitro-1H-pyrrole-2-carbonyl)amino]-4-oxobutanoic acid |
| SMILES | NC(=O)CC(NC(=O)c1ccc([N+](=O)[O-])[nH]1)C(=O)O |
| InChI | InChI=1S/C9H10N4O6/c10-6(14)3-5(9(16)17)12-8(15)4-1-2-7(11-4)13(18)19/h1-2,5,11H,3H2,(H2,10,14)(H,12,15)(H,16,17) |
| InChIKey | FGVMLKYTUNHKAZ-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 168.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.20 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|