C7H10N4O3 — CID 60964878
N-(2-aminoethyl)-5-nitro-1H-pyrrole-2-carboxamide (PubChem CID 60964878) has the molecular formula C7H10N4O3 and a molecular weight of 198.18 g/mol. Its IUPAC name is N-(2-aminoethyl)-5-nitro-1H-pyrrole-2-carboxamide.
| Compound Name | N-(2-aminoethyl)-5-nitro-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 60964878 |
| Molecular Formula | C7H10N4O3 |
| Molecular Weight | 198.18 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | N-(2-aminoethyl)-5-nitro-1H-pyrrole-2-carboxamide |
| SMILES | NCCNC(=O)c1ccc([N+](=O)[O-])[nH]1 |
| InChI | InChI=1S/C7H10N4O3/c8-3-4-9-7(12)5-1-2-6(10-5)11(13)14/h1-2,10H,3-4,8H2,(H,9,12) |
| InChIKey | INIWMIMTLRQBSX-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 114.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.18 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|