C8H7N3O3 — CID 61068795
5-nitro-N-prop-2-ynyl-1H-pyrrole-2-carboxamide (PubChem CID 61068795) has the molecular formula C8H7N3O3 and a molecular weight of 193.16 g/mol. Its IUPAC name is 5-nitro-N-prop-2-ynyl-1H-pyrrole-2-carboxamide.
| Compound Name | 5-nitro-N-prop-2-ynyl-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 61068795 |
| Molecular Formula | C8H7N3O3 |
| Molecular Weight | 193.16 g/mol |
| Exact Mass | 193.05 |
| IUPAC Name | 5-nitro-N-prop-2-ynyl-1H-pyrrole-2-carboxamide |
| SMILES | C#CCNC(=O)c1ccc([N+](=O)[O-])[nH]1 |
| InChI | InChI=1S/C8H7N3O3/c1-2-5-9-8(12)6-3-4-7(10-6)11(13)14/h1,3-4,10H,5H2,(H,9,12) |
| InChIKey | MPUITMUOQLJWGM-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 88.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.16 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|