C8H12N4O3 — CID 104873145
N-[(2R)-1-aminopropan-2-yl]-5-nitro-1H-pyrrole-2-carboxamide (PubChem CID 104873145) has the molecular formula C8H12N4O3 and a molecular weight of 212.21 g/mol. Its IUPAC name is N-[(2R)-1-aminopropan-2-yl]-5-nitro-1H-pyrrole-2-carboxamide.
| Compound Name | N-[(2R)-1-aminopropan-2-yl]-5-nitro-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 104873145 |
| Molecular Formula | C8H12N4O3 |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | N-[(2R)-1-aminopropan-2-yl]-5-nitro-1H-pyrrole-2-carboxamide |
| SMILES | C[C@H](CN)NC(=O)c1ccc([N+](=O)[O-])[nH]1 |
| InChI | InChI=1S/C8H12N4O3/c1-5(4-9)10-8(13)6-2-3-7(11-6)12(14)15/h2-3,5,11H,4,9H2,1H3,(H,10,13)/t5-/m1/s1 |
| InChIKey | GZUSQADWZLQCTI-RXMQYKEDSA-N |
| XLogP | -0.00 |
| TPSA | 114.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|