C9H12ClN3O4 — CID 106182844
N-(1-chloro-3-methoxypropan-2-yl)-5-nitro-1H-pyrrole-2-carboxamide (PubChem CID 106182844) has the molecular formula C9H12ClN3O4 and a molecular weight of 261.67 g/mol. Its IUPAC name is N-(1-chloro-3-methoxypropan-2-yl)-5-nitro-1H-pyrrole-2-carboxamide.
| Compound Name | N-(1-chloro-3-methoxypropan-2-yl)-5-nitro-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 106182844 |
| Molecular Formula | C9H12ClN3O4 |
| Molecular Weight | 261.67 g/mol |
| Exact Mass | 261.05 |
| IUPAC Name | N-(1-chloro-3-methoxypropan-2-yl)-5-nitro-1H-pyrrole-2-carboxamide |
| SMILES | COCC(CCl)NC(=O)c1ccc([N+](=O)[O-])[nH]1 |
| InChI | InChI=1S/C9H12ClN3O4/c1-17-5-6(4-10)11-9(14)7-2-3-8(12-7)13(15)16/h2-3,6,12H,4-5H2,1H3,(H,11,14) |
| InChIKey | XEULVNVUMQTRJK-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 97.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.67 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|