C16H17N3O4 — CID 26708469
N-[(1S)-1-(2,5-dimethylphenyl)ethyl]-5-nitro-2-oxo-1H-pyridine-3-carboxamide (PubChem CID 26708469) has the molecular formula C16H17N3O4 and a molecular weight of 315.33 g/mol. Its IUPAC name is N-[(1S)-1-(2,5-dimethylphenyl)ethyl]-5-nitro-2-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N-[(1S)-1-(2,5-dimethylphenyl)ethyl]-5-nitro-2-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 26708469 |
| Molecular Formula | C16H17N3O4 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | N-[(1S)-1-(2,5-dimethylphenyl)ethyl]-5-nitro-2-oxo-1H-pyridine-3-carboxamide |
| SMILES | Cc1ccc(C)c([C@H](C)NC(=O)c2cc([N+](=O)[O-])c[nH]c2=O)c1 |
| InChI | InChI=1S/C16H17N3O4/c1-9-4-5-10(2)13(6-9)11(3)18-16(21)14-7-12(19(22)23)8-17-15(14)20/h4-8,11H,1-3H3,(H,17,20)(H,18,21)/t11-/m0/s1 |
| InChIKey | HFFMFGGCYILHAC-NSHDSACASA-N |
| XLogP | 2.39 |
| TPSA | 105.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|