C9H7ClF3N3O3 — CID 103803623
2-chloro-N-methyl-5-nitro-N-(2,2,2-trifluoroethyl)pyridine-3-carboxamide (PubChem CID 103803623) has the molecular formula C9H7ClF3N3O3 and a molecular weight of 297.62 g/mol. Its IUPAC name is 2-chloro-N-methyl-5-nitro-N-(2,2,2-trifluoroethyl)pyridine-3-carboxamide.
| Compound Name | 2-chloro-N-methyl-5-nitro-N-(2,2,2-trifluoroethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 103803623 |
| Molecular Formula | C9H7ClF3N3O3 |
| Molecular Weight | 297.62 g/mol |
| Exact Mass | 297.01 |
| IUPAC Name | 2-chloro-N-methyl-5-nitro-N-(2,2,2-trifluoroethyl)pyridine-3-carboxamide |
| SMILES | CN(CC(F)(F)F)C(=O)c1cc([N+](=O)[O-])cnc1Cl |
| InChI | InChI=1S/C9H7ClF3N3O3/c1-15(4-9(11,12)13)8(17)6-2-5(16(18)19)3-14-7(6)10/h2-3H,4H2,1H3 |
| InChIKey | BTBJXPHKYYXFRC-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 76.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.62 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|