C14H13BrCl2N2OS — CID 107184564
5-amino-N-[(5-bromothiophen-2-yl)methyl]-2,3-dichloro-N-ethylbenzamide (PubChem CID 107184564) has the molecular formula C14H13BrCl2N2OS and a molecular weight of 408.15 g/mol. Its IUPAC name is 5-amino-N-[(5-bromothiophen-2-yl)methyl]-2,3-dichloro-N-ethylbenzamide.
| Compound Name | 5-amino-N-[(5-bromothiophen-2-yl)methyl]-2,3-dichloro-N-ethylbenzamide |
|---|---|
| PubChem CID | 107184564 |
| Molecular Formula | C14H13BrCl2N2OS |
| Molecular Weight | 408.15 g/mol |
| Exact Mass | 405.93 |
| IUPAC Name | 5-amino-N-[(5-bromothiophen-2-yl)methyl]-2,3-dichloro-N-ethylbenzamide |
| SMILES | CCN(Cc1ccc(Br)s1)C(=O)c1cc(N)cc(Cl)c1Cl |
| InChI | InChI=1S/C14H13BrCl2N2OS/c1-2-19(7-9-3-4-12(15)21-9)14(20)10-5-8(18)6-11(16)13(10)17/h3-6H,2,7,18H2,1H3 |
| InChIKey | WTIQKZHGOGMNGI-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.15 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|