C14H16Cl2N2O4 — CID 9115326
ethyl N-[2-[(2,5-dichlorobenzoyl)-ethylamino]acetyl]carbamate (PubChem CID 9115326) has the molecular formula C14H16Cl2N2O4 and a molecular weight of 347.20 g/mol. Its IUPAC name is ethyl N-[2-[(2,5-dichlorobenzoyl)-ethylamino]acetyl]carbamate.
| Compound Name | ethyl N-[2-[(2,5-dichlorobenzoyl)-ethylamino]acetyl]carbamate |
|---|---|
| PubChem CID | 9115326 |
| Molecular Formula | C14H16Cl2N2O4 |
| Molecular Weight | 347.20 g/mol |
| Exact Mass | 346.05 |
| IUPAC Name | ethyl N-[2-[(2,5-dichlorobenzoyl)-ethylamino]acetyl]carbamate |
| SMILES | CCOC(=O)NC(=O)CN(CC)C(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H16Cl2N2O4/c1-3-18(8-12(19)17-14(21)22-4-2)13(20)10-7-9(15)5-6-11(10)16/h5-7H,3-4,8H2,1-2H3,(H,17,19,21) |
| InChIKey | UAPUBQANRCFSKZ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.20 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |