C19H17Cl2N3O2 — CID 25313237
N-[2-(2,6-dichloroanilino)-2-oxoethyl]-N-ethyl-1H-indole-2-carboxamide (PubChem CID 25313237) has the molecular formula C19H17Cl2N3O2 and a molecular weight of 390.27 g/mol. Its IUPAC name is N-[2-(2,6-dichloroanilino)-2-oxoethyl]-N-ethyl-1H-indole-2-carboxamide.
| Compound Name | N-[2-(2,6-dichloroanilino)-2-oxoethyl]-N-ethyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 25313237 |
| Molecular Formula | C19H17Cl2N3O2 |
| Molecular Weight | 390.27 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | N-[2-(2,6-dichloroanilino)-2-oxoethyl]-N-ethyl-1H-indole-2-carboxamide |
| SMILES | CCN(CC(=O)Nc1c(Cl)cccc1Cl)C(=O)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C19H17Cl2N3O2/c1-2-24(11-17(25)23-18-13(20)7-5-8-14(18)21)19(26)16-10-12-6-3-4-9-15(12)22-16/h3-10,22H,2,11H2,1H3,(H,23,25) |
| InChIKey | NYXQJGMYXDZQFN-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.27 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |