C16H20ClN3O2 — CID 134002575
5-chloro-N-ethyl-N-[2-oxo-2-(propan-2-ylamino)ethyl]-1H-indole-2-carboxamide (PubChem CID 134002575) has the molecular formula C16H20ClN3O2 and a molecular weight of 321.81 g/mol. Its IUPAC name is 5-chloro-N-ethyl-N-[2-oxo-2-(propan-2-ylamino)ethyl]-1H-indole-2-carboxamide.
| Compound Name | 5-chloro-N-ethyl-N-[2-oxo-2-(propan-2-ylamino)ethyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 134002575 |
| Molecular Formula | C16H20ClN3O2 |
| Molecular Weight | 321.81 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | 5-chloro-N-ethyl-N-[2-oxo-2-(propan-2-ylamino)ethyl]-1H-indole-2-carboxamide |
| SMILES | CCN(CC(=O)NC(C)C)C(=O)c1cc2cc(Cl)ccc2[nH]1 |
| InChI | InChI=1S/C16H20ClN3O2/c1-4-20(9-15(21)18-10(2)3)16(22)14-8-11-7-12(17)5-6-13(11)19-14/h5-8,10,19H,4,9H2,1-3H3,(H,18,21) |
| InChIKey | HYQNAWNNTLRVLZ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.81 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |