C13H15BrN2O — CID 46555997
5-bromo-N,N-diethyl-1H-indole-2-carboxamide (PubChem CID 46555997) has the molecular formula C13H15BrN2O and a molecular weight of 295.18 g/mol. Its IUPAC name is 5-bromo-N,N-diethyl-1H-indole-2-carboxamide.
| Compound Name | 5-bromo-N,N-diethyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 46555997 |
| Molecular Formula | C13H15BrN2O |
| Molecular Weight | 295.18 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | 5-bromo-N,N-diethyl-1H-indole-2-carboxamide |
| SMILES | CCN(CC)C(=O)c1cc2cc(Br)ccc2[nH]1 |
| InChI | InChI=1S/C13H15BrN2O/c1-3-16(4-2)13(17)12-8-9-7-10(14)5-6-11(9)15-12/h5-8,15H,3-4H2,1-2H3 |
| InChIKey | YYVRKVYPYHQWCF-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.18 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |