C20H20ClN3O3 — CID 38805224
5-chloro-N-ethyl-N-[2-(2-methoxyanilino)-2-oxoethyl]-1H-indole-2-carboxamide (PubChem CID 38805224) has the molecular formula C20H20ClN3O3 and a molecular weight of 385.85 g/mol. Its IUPAC name is 5-chloro-N-ethyl-N-[2-(2-methoxyanilino)-2-oxoethyl]-1H-indole-2-carboxamide.
| Compound Name | 5-chloro-N-ethyl-N-[2-(2-methoxyanilino)-2-oxoethyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 38805224 |
| Molecular Formula | C20H20ClN3O3 |
| Molecular Weight | 385.85 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | 5-chloro-N-ethyl-N-[2-(2-methoxyanilino)-2-oxoethyl]-1H-indole-2-carboxamide |
| SMILES | CCN(CC(=O)Nc1ccccc1OC)C(=O)c1cc2cc(Cl)ccc2[nH]1 |
| InChI | InChI=1S/C20H20ClN3O3/c1-3-24(12-19(25)23-16-6-4-5-7-18(16)27-2)20(26)17-11-13-10-14(21)8-9-15(13)22-17/h4-11,22H,3,12H2,1-2H3,(H,23,25) |
| InChIKey | PJYXSRZSJBGLMH-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.85 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |