C17H18BrClN2O5S — CID 24684114
4-bromo-N-(2-chloro-4,5-dimethoxyphenyl)-3-(dimethylsulfamoyl)benzamide (PubChem CID 24684114) has the molecular formula C17H18BrClN2O5S and a molecular weight of 477.76 g/mol. Its IUPAC name is 4-bromo-N-(2-chloro-4,5-dimethoxyphenyl)-3-(dimethylsulfamoyl)benzamide.
| Compound Name | 4-bromo-N-(2-chloro-4,5-dimethoxyphenyl)-3-(dimethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 24684114 |
| Molecular Formula | C17H18BrClN2O5S |
| Molecular Weight | 477.76 g/mol |
| Exact Mass | 475.98 |
| IUPAC Name | 4-bromo-N-(2-chloro-4,5-dimethoxyphenyl)-3-(dimethylsulfamoyl)benzamide |
| SMILES | COc1cc(Cl)c(NC(=O)c2ccc(Br)c(S(=O)(=O)N(C)C)c2)cc1OC |
| InChI | InChI=1S/C17H18BrClN2O5S/c1-21(2)27(23,24)16-7-10(5-6-11(16)18)17(22)20-13-9-15(26-4)14(25-3)8-12(13)19/h5-9H,1-4H3,(H,20,22) |
| InChIKey | KUPQYAVGKCCGKF-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.76 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |