C18H21ClN2O6S — CID 26102014
4-chloro-3-(dimethylsulfamoyl)-N-(3,4,5-trimethoxyphenyl)benzamide (PubChem CID 26102014) has the molecular formula C18H21ClN2O6S and a molecular weight of 428.89 g/mol. Its IUPAC name is 4-chloro-3-(dimethylsulfamoyl)-N-(3,4,5-trimethoxyphenyl)benzamide.
| Compound Name | 4-chloro-3-(dimethylsulfamoyl)-N-(3,4,5-trimethoxyphenyl)benzamide |
|---|---|
| PubChem CID | 26102014 |
| Molecular Formula | C18H21ClN2O6S |
| Molecular Weight | 428.89 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | 4-chloro-3-(dimethylsulfamoyl)-N-(3,4,5-trimethoxyphenyl)benzamide |
| SMILES | COc1cc(NC(=O)c2ccc(Cl)c(S(=O)(=O)N(C)C)c2)cc(OC)c1OC |
| InChI | InChI=1S/C18H21ClN2O6S/c1-21(2)28(23,24)16-8-11(6-7-13(16)19)18(22)20-12-9-14(25-3)17(27-5)15(10-12)26-4/h6-10H,1-5H3,(H,20,22) |
| InChIKey | ZWVBSJFSXZRSKB-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.89 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |