C20H21ClN2O7S — CID 164616717
3-[[(E)-but-2-enoyl]sulfamoyl]-4-chloro-N-(3,4,5-trimethoxyphenyl)benzamide (PubChem CID 164616717) has the molecular formula C20H21ClN2O7S and a molecular weight of 468.92 g/mol. Its IUPAC name is 3-[[(E)-but-2-enoyl]sulfamoyl]-4-chloro-N-(3,4,5-trimethoxyphenyl)benzamide.
| Compound Name | 3-[[(E)-but-2-enoyl]sulfamoyl]-4-chloro-N-(3,4,5-trimethoxyphenyl)benzamide |
|---|---|
| PubChem CID | 164616717 |
| Molecular Formula | C20H21ClN2O7S |
| Molecular Weight | 468.92 g/mol |
| Exact Mass | 468.08 |
| IUPAC Name | 3-[[(E)-but-2-enoyl]sulfamoyl]-4-chloro-N-(3,4,5-trimethoxyphenyl)benzamide |
| SMILES | C/C=C/C(=O)NS(=O)(=O)c1cc(C(=O)Nc2cc(OC)c(OC)c(OC)c2)ccc1Cl |
| InChI | InChI=1S/C20H21ClN2O7S/c1-5-6-18(24)23-31(26,27)17-9-12(7-8-14(17)21)20(25)22-13-10-15(28-2)19(30-4)16(11-13)29-3/h5-11H,1-4H3,(H,22,25)(H,23,24)/b6-5+ |
| InChIKey | BTGPHYIAALSSGZ-AATRIKPKSA-N |
| XLogP | 3.00 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.92 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|