C19H22ClN3O5S — CID 55670093
N-[2-chloro-5-(dimethylcarbamoyl)phenyl]-3-(dimethylsulfamoyl)-4-methoxybenzamide (PubChem CID 55670093) has the molecular formula C19H22ClN3O5S and a molecular weight of 439.92 g/mol. Its IUPAC name is N-[2-chloro-5-(dimethylcarbamoyl)phenyl]-3-(dimethylsulfamoyl)-4-methoxybenzamide.
| Compound Name | N-[2-chloro-5-(dimethylcarbamoyl)phenyl]-3-(dimethylsulfamoyl)-4-methoxybenzamide |
|---|---|
| PubChem CID | 55670093 |
| Molecular Formula | C19H22ClN3O5S |
| Molecular Weight | 439.92 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | N-[2-chloro-5-(dimethylcarbamoyl)phenyl]-3-(dimethylsulfamoyl)-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2cc(C(=O)N(C)C)ccc2Cl)cc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C19H22ClN3O5S/c1-22(2)19(25)13-6-8-14(20)15(10-13)21-18(24)12-7-9-16(28-5)17(11-12)29(26,27)23(3)4/h6-11H,1-5H3,(H,21,24) |
| InChIKey | SNLASSWMXPYQTJ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.92 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |