C26H29FN4O3S — CID 112809859
N-[2-(4-ethylpiperazin-1-yl)phenyl]-3-[(4-fluorophenyl)sulfamoyl]-4-methylbenzamide (PubChem CID 112809859) has the molecular formula C26H29FN4O3S and a molecular weight of 496.61 g/mol. Its IUPAC name is N-[2-(4-ethylpiperazin-1-yl)phenyl]-3-[(4-fluorophenyl)sulfamoyl]-4-methylbenzamide.
| Compound Name | N-[2-(4-ethylpiperazin-1-yl)phenyl]-3-[(4-fluorophenyl)sulfamoyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 112809859 |
| Molecular Formula | C26H29FN4O3S |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | N-[2-(4-ethylpiperazin-1-yl)phenyl]-3-[(4-fluorophenyl)sulfamoyl]-4-methylbenzamide |
| SMILES | CCN1CCN(c2ccccc2NC(=O)c2ccc(C)c(S(=O)(=O)Nc3ccc(F)cc3)c2)CC1 |
| InChI | InChI=1S/C26H29FN4O3S/c1-3-30-14-16-31(17-15-30)24-7-5-4-6-23(24)28-26(32)20-9-8-19(2)25(18-20)35(33,34)29-22-12-10-21(27)11-13-22/h4-13,18,29H,3,14-17H2,1-2H3,(H,28,32) |
| InChIKey | WAHATUGWMHENJZ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |