C24H30ClN3O4S — CID 16550994
N-(5-chloro-2-morpholin-4-ylphenyl)-3-(3,5-dimethylpiperidin-1-yl)sulfonylbenzamide (PubChem CID 16550994) has the molecular formula C24H30ClN3O4S and a molecular weight of 492.04 g/mol. Its IUPAC name is N-(5-chloro-2-morpholin-4-ylphenyl)-3-(3,5-dimethylpiperidin-1-yl)sulfonylbenzamide.
| Compound Name | N-(5-chloro-2-morpholin-4-ylphenyl)-3-(3,5-dimethylpiperidin-1-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 16550994 |
| Molecular Formula | C24H30ClN3O4S |
| Molecular Weight | 492.04 g/mol |
| Exact Mass | 491.16 |
| IUPAC Name | N-(5-chloro-2-morpholin-4-ylphenyl)-3-(3,5-dimethylpiperidin-1-yl)sulfonylbenzamide |
| SMILES | CC1CC(C)CN(S(=O)(=O)c2cccc(C(=O)Nc3cc(Cl)ccc3N3CCOCC3)c2)C1 |
| InChI | InChI=1S/C24H30ClN3O4S/c1-17-12-18(2)16-28(15-17)33(30,31)21-5-3-4-19(13-21)24(29)26-22-14-20(25)6-7-23(22)27-8-10-32-11-9-27/h3-7,13-14,17-18H,8-12,15-16H2,1-2H3,(H,26,29) |
| InChIKey | DHNJMSABKDWKIS-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.04 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |