C20H22BrN3O5S — CID 1330759
4-bromo-3-[(3S,5R)-3,5-dimethylpiperidin-1-yl]sulfonyl-N-(3-nitrophenyl)benzamide (PubChem CID 1330759) has the molecular formula C20H22BrN3O5S and a molecular weight of 496.38 g/mol. Its IUPAC name is 4-bromo-3-[(3S,5R)-3,5-dimethylpiperidin-1-yl]sulfonyl-N-(3-nitrophenyl)benzamide.
| Compound Name | 4-bromo-3-[(3S,5R)-3,5-dimethylpiperidin-1-yl]sulfonyl-N-(3-nitrophenyl)benzamide |
|---|---|
| PubChem CID | 1330759 |
| Molecular Formula | C20H22BrN3O5S |
| Molecular Weight | 496.38 g/mol |
| Exact Mass | 495.05 |
| IUPAC Name | 4-bromo-3-[(3S,5R)-3,5-dimethylpiperidin-1-yl]sulfonyl-N-(3-nitrophenyl)benzamide |
| SMILES | C[C@@H]1C[C@H](C)CN(S(=O)(=O)c2cc(C(=O)Nc3cccc([N+](=O)[O-])c3)ccc2Br)C1 |
| InChI | InChI=1S/C20H22BrN3O5S/c1-13-8-14(2)12-23(11-13)30(28,29)19-9-15(6-7-18(19)21)20(25)22-16-4-3-5-17(10-16)24(26)27/h3-7,9-10,13-14H,8,11-12H2,1-2H3,(H,22,25)/t13-,14+ |
| InChIKey | DFRKBHUDDKZXSN-OKILXGFUSA-N |
| XLogP | 4.28 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.38 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|