C27H44N4O3S — CID 20630293
4-(tert-butylsulfonylamino)-N-[4-(4-cyclohexylpiperazin-1-yl)phenyl]cyclohexane-1-carboxamide (PubChem CID 20630293) has the molecular formula C27H44N4O3S and a molecular weight of 504.74 g/mol. Its IUPAC name is 4-(tert-butylsulfonylamino)-N-[4-(4-cyclohexylpiperazin-1-yl)phenyl]cyclohexane-1-carboxamide.
| Compound Name | 4-(tert-butylsulfonylamino)-N-[4-(4-cyclohexylpiperazin-1-yl)phenyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 20630293 |
| Molecular Formula | C27H44N4O3S |
| Molecular Weight | 504.74 g/mol |
| Exact Mass | 504.31 |
| IUPAC Name | 4-(tert-butylsulfonylamino)-N-[4-(4-cyclohexylpiperazin-1-yl)phenyl]cyclohexane-1-carboxamide |
| SMILES | CC(C)(C)S(=O)(=O)NC1CCC(C(=O)Nc2ccc(N3CCN(C4CCCCC4)CC3)cc2)CC1 |
| InChI | InChI=1S/C27H44N4O3S/c1-27(2,3)35(33,34)29-23-11-9-21(10-12-23)26(32)28-22-13-15-25(16-14-22)31-19-17-30(18-20-31)24-7-5-4-6-8-24/h13-16,21,23-24,29H,4-12,17-20H2,1-3H3,(H,28,32) |
| InChIKey | HFQRHOIITLFDMV-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.74 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|