C20H31N3O3S2 — CID 70792939
4-(tert-butylsulfonylamino)-N-[4-(1,2-thiazolidin-2-yl)phenyl]cyclohexane-1-carboxamide (PubChem CID 70792939) has the molecular formula C20H31N3O3S2 and a molecular weight of 425.62 g/mol. Its IUPAC name is 4-(tert-butylsulfonylamino)-N-[4-(1,2-thiazolidin-2-yl)phenyl]cyclohexane-1-carboxamide.
| Compound Name | 4-(tert-butylsulfonylamino)-N-[4-(1,2-thiazolidin-2-yl)phenyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 70792939 |
| Molecular Formula | C20H31N3O3S2 |
| Molecular Weight | 425.62 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | 4-(tert-butylsulfonylamino)-N-[4-(1,2-thiazolidin-2-yl)phenyl]cyclohexane-1-carboxamide |
| SMILES | CC(C)(C)S(=O)(=O)NC1CCC(C(=O)Nc2ccc(N3CCCS3)cc2)CC1 |
| InChI | InChI=1S/C20H31N3O3S2/c1-20(2,3)28(25,26)22-17-7-5-15(6-8-17)19(24)21-16-9-11-18(12-10-16)23-13-4-14-27-23/h9-12,15,17,22H,4-8,13-14H2,1-3H3,(H,21,24) |
| InChIKey | QJEHBUGNPJKWTM-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.62 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|