C20H33N3O3S — CID 20630756
N-(4-tert-butylphenyl)-4-(tert-butylsulfonylamino)piperidine-1-carboxamide (PubChem CID 20630756) has the molecular formula C20H33N3O3S and a molecular weight of 395.57 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-4-(tert-butylsulfonylamino)piperidine-1-carboxamide.
| Compound Name | N-(4-tert-butylphenyl)-4-(tert-butylsulfonylamino)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 20630756 |
| Molecular Formula | C20H33N3O3S |
| Molecular Weight | 395.57 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | N-(4-tert-butylphenyl)-4-(tert-butylsulfonylamino)piperidine-1-carboxamide |
| SMILES | CC(C)(C)c1ccc(NC(=O)N2CCC(NS(=O)(=O)C(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C20H33N3O3S/c1-19(2,3)15-7-9-16(10-8-15)21-18(24)23-13-11-17(12-14-23)22-27(25,26)20(4,5)6/h7-10,17,22H,11-14H2,1-6H3,(H,21,24) |
| InChIKey | HIAUICLVPPBESP-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.57 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |