C22H21N5O4S2 — CID 175196266
2-[4-[methyl(sulfino)amino]anilino]-8-[4-[methyl(sulfino)amino]phenyl]quinazoline (PubChem CID 175196266) has the molecular formula C22H21N5O4S2 and a molecular weight of 483.58 g/mol. Its IUPAC name is 2-[4-[methyl(sulfino)amino]anilino]-8-[4-[methyl(sulfino)amino]phenyl]quinazoline.
| Compound Name | 2-[4-[methyl(sulfino)amino]anilino]-8-[4-[methyl(sulfino)amino]phenyl]quinazoline |
|---|---|
| PubChem CID | 175196266 |
| Molecular Formula | C22H21N5O4S2 |
| Molecular Weight | 483.58 g/mol |
| Exact Mass | 483.10 |
| IUPAC Name | 2-[4-[methyl(sulfino)amino]anilino]-8-[4-[methyl(sulfino)amino]phenyl]quinazoline |
| SMILES | CN(c1ccc(Nc2ncc3cccc(-c4ccc(N(C)S(=O)O)cc4)c3n2)cc1)S(=O)O |
| InChI | InChI=1S/C22H21N5O4S2/c1-26(32(28)29)18-10-6-15(7-11-18)20-5-3-4-16-14-23-22(25-21(16)20)24-17-8-12-19(13-9-17)27(2)33(30)31/h3-14H,1-2H3,(H,28,29)(H,30,31)(H,23,24,25) |
| InChIKey | DLIBUDGVDCCNQJ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 118.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.58 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|