C26H26N4O3 — CID 144797231
2-[4-[[8-[3-(methylamino)phenyl]quinazolin-2-yl]amino]phenoxy]ethanol;prop-2-enal (PubChem CID 144797231) has the molecular formula C26H26N4O3 and a molecular weight of 442.52 g/mol. Its IUPAC name is 2-[4-[[8-[3-(methylamino)phenyl]quinazolin-2-yl]amino]phenoxy]ethanol;prop-2-enal.
| Compound Name | 2-[4-[[8-[3-(methylamino)phenyl]quinazolin-2-yl]amino]phenoxy]ethanol;prop-2-enal |
|---|---|
| PubChem CID | 144797231 |
| Molecular Formula | C26H26N4O3 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | 2-[4-[[8-[3-(methylamino)phenyl]quinazolin-2-yl]amino]phenoxy]ethanol;prop-2-enal |
| SMILES | C=CC=O.CNc1cccc(-c2cccc3cnc(Nc4ccc(OCCO)cc4)nc23)c1 |
| InChI | InChI=1S/C23H22N4O2.C3H4O/c1-24-19-6-2-4-16(14-19)21-7-3-5-17-15-25-23(27-22(17)21)26-18-8-10-20(11-9-18)29-13-12-28;1-2-3-4/h2-11,14-15,24,28H,12-13H2,1H3,(H,25,26,27);2-3H,1H2 |
| InChIKey | HMKDLWKCCYLGCV-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 96.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|