C23H22N4O2 — CID 138463296
2-[4-[[8-[3-(methylamino)phenyl]quinazolin-2-yl]amino]phenoxy]ethanol (PubChem CID 138463296) has the molecular formula C23H22N4O2 and a molecular weight of 386.46 g/mol. Its IUPAC name is 2-[4-[[8-[3-(methylamino)phenyl]quinazolin-2-yl]amino]phenoxy]ethanol.
| Compound Name | 2-[4-[[8-[3-(methylamino)phenyl]quinazolin-2-yl]amino]phenoxy]ethanol |
|---|---|
| PubChem CID | 138463296 |
| Molecular Formula | C23H22N4O2 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 2-[4-[[8-[3-(methylamino)phenyl]quinazolin-2-yl]amino]phenoxy]ethanol |
| SMILES | CNc1cccc(-c2cccc3cnc(Nc4ccc(OCCO)cc4)nc23)c1 |
| InChI | InChI=1S/C23H22N4O2/c1-24-19-6-2-4-16(14-19)21-7-3-5-17-15-25-23(27-22(17)21)26-18-8-10-20(11-9-18)29-13-12-28/h2-11,14-15,24,28H,12-13H2,1H3,(H,25,26,27) |
| InChIKey | PJKQDDSVYUHMHI-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 79.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |